C20H11F2NO5 — CID 141031952
7-(3,4-difluorophenyl)-10H-phenoxazine-1,3-dicarboxylic acid (PubChem CID 141031952) has the molecular formula C20H11F2NO5 and a molecular weight of 383.31 g/mol. Its IUPAC name is 7-(3,4-difluorophenyl)-10H-phenoxazine-1,3-dicarboxylic acid.
| Compound Name | 7-(3,4-difluorophenyl)-10H-phenoxazine-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 141031952 |
| Molecular Formula | C20H11F2NO5 |
| Molecular Weight | 383.31 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | 7-(3,4-difluorophenyl)-10H-phenoxazine-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1cc2c(c(C(=O)O)c1)Nc1ccc(-c3ccc(F)c(F)c3)cc1O2 |
| InChI | InChI=1S/C20H11F2NO5/c21-13-3-1-9(6-14(13)22)10-2-4-15-16(7-10)28-17-8-11(19(24)25)5-12(20(26)27)18(17)23-15/h1-8,23H,(H,24,25)(H,26,27) |
| InChIKey | KRTSRDZEFYNUPB-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.31 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |