C22H16N2O3 — CID 141031888
3-cyano-7-(3,4-dimethylphenyl)-10H-phenoxazine-1-carboxylic acid (PubChem CID 141031888) has the molecular formula C22H16N2O3 and a molecular weight of 356.38 g/mol. Its IUPAC name is 3-cyano-7-(3,4-dimethylphenyl)-10H-phenoxazine-1-carboxylic acid.
| Compound Name | 3-cyano-7-(3,4-dimethylphenyl)-10H-phenoxazine-1-carboxylic acid |
|---|---|
| PubChem CID | 141031888 |
| Molecular Formula | C22H16N2O3 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 3-cyano-7-(3,4-dimethylphenyl)-10H-phenoxazine-1-carboxylic acid |
| SMILES | Cc1ccc(-c2ccc3c(c2)Oc2cc(C#N)cc(C(=O)O)c2N3)cc1C |
| InChI | InChI=1S/C22H16N2O3/c1-12-3-4-15(7-13(12)2)16-5-6-18-19(10-16)27-20-9-14(11-23)8-17(22(25)26)21(20)24-18/h3-10,24H,1-2H3,(H,25,26) |
| InChIKey | FKDBKFFFVLZOIH-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |