About 5-(3,4-dimethylphenyl)-2-methyl-1H-pyrrole-3-carboxylic acid
5-(3,4-dimethylphenyl)-2-methyl-1H-pyrrole-3-carboxylic acid (PubChem CID 4715364) has the molecular formula C14H15NO2
and a molecular weight of 229.28 g/mol. Its IUPAC name is 5-(3,4-dimethylphenyl)-2-methyl-1H-pyrrole-3-carboxylic acid.
Analyze 5-(3,4-dimethylphenyl)-2-methyl-1H-pyrrole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,4-dimethylphenyl)-2-methyl-1H-pyrrole-3-carboxylic acid?
The IUPAC name of 5-(3,4-dimethylphenyl)-2-methyl-1H-pyrrole-3-carboxylic acid (CID 4715364) is 5-(3,4-dimethylphenyl)-2-methyl-1H-pyrrole-3-carboxylic acid.
What is the SMILES notation for 5-(3,4-dimethylphenyl)-2-methyl-1H-pyrrole-3-carboxylic acid?
The canonical SMILES for 5-(3,4-dimethylphenyl)-2-methyl-1H-pyrrole-3-carboxylic acid is Cc1ccc(-c2cc(C(=O)O)c(C)[nH]2)cc1C.
What is the InChIKey of 5-(3,4-dimethylphenyl)-2-methyl-1H-pyrrole-3-carboxylic acid?
The InChIKey is IVINRFQYECVDKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO2/c1-8-4-5-11(6-9(8)2)13-7-12(14(16)17)10(3)15-13/h4-7,15H,1-3H3,(H,16,17).
What are the key properties of 5-(3,4-dimethylphenyl)-2-methyl-1H-pyrrole-3-carboxylic acid?
5-(3,4-dimethylphenyl)-2-methyl-1H-pyrrole-3-carboxylic acid has a molecular weight of 229.28 g/mol, XLogP of 3.31, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,4-dimethylphenyl)-2-methyl-1H-pyrrole-3-carboxylic acid is sourced from PubChem (CID 4715364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).