C18H20O2 — CID 63490073
1-(5-benzyl-2-hydroxyphenyl)-2,2-dimethylpropan-1-one (PubChem CID 63490073) has the molecular formula C18H20O2 and a molecular weight of 268.36 g/mol. Its IUPAC name is 1-(5-benzyl-2-hydroxyphenyl)-2,2-dimethylpropan-1-one.
| Compound Name | 1-(5-benzyl-2-hydroxyphenyl)-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 63490073 |
| Molecular Formula | C18H20O2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 1-(5-benzyl-2-hydroxyphenyl)-2,2-dimethylpropan-1-one |
| SMILES | CC(C)(C)C(=O)c1cc(Cc2ccccc2)ccc1O |
| InChI | InChI=1S/C18H20O2/c1-18(2,3)17(20)15-12-14(9-10-16(15)19)11-13-7-5-4-6-8-13/h4-10,12,19H,11H2,1-3H3 |
| InChIKey | AUZCASIXFWWGSA-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |