About dipotassium;5-[(3-carboxylato-4-hydroxyphenyl)methyl]-2-hydroxybenzoate
dipotassium;5-[(3-carboxylato-4-hydroxyphenyl)methyl]-2-hydroxybenzoate (PubChem CID 22945073) has the molecular formula C15H10K2O6
and a molecular weight of 364.44 g/mol. Its IUPAC name is dipotassium;5-[(3-carboxylato-4-hydroxyphenyl)methyl]-2-hydroxybenzoate.
Molecular Properties
| Compound Name | dipotassium;5-[(3-carboxylato-4-hydroxyphenyl)methyl]-2-hydroxybenzoate |
| PubChem CID | 22945073 |
| Molecular Formula | C15H10K2O6 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 363.98 |
| IUPAC Name | dipotassium;5-[(3-carboxylato-4-hydroxyphenyl)methyl]-2-hydroxybenzoate |
| SMILES | O=C([O-])c1cc(Cc2ccc(O)c(C(=O)[O-])c2)ccc1O.[K+].[K+] |
| InChI | InChI=1S/C15H12O6.2K/c16-12-3-1-8(6-10(12)14(18)19)5-9-2-4-13(17)11(7-9)15(20)21;;/h1-4,6-7,16-17H,5H2,(H,18,19)(H,20,21);;/q;2*+1/p-2 |
| InChIKey | HDRZHGSDUWMJSK-UHFFFAOYSA-L |
| XLogP | -6.58 |
| TPSA | 120.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | -6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze dipotassium;5-[(3-carboxylato-4-hydroxyphenyl)methyl]-2-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipotassium;5-[(3-carboxylato-4-hydroxyphenyl)methyl]-2-hydroxybenzoate?
The IUPAC name of dipotassium;5-[(3-carboxylato-4-hydroxyphenyl)methyl]-2-hydroxybenzoate (CID 22945073) is dipotassium;5-[(3-carboxylato-4-hydroxyphenyl)methyl]-2-hydroxybenzoate.
What is the SMILES notation for dipotassium;5-[(3-carboxylato-4-hydroxyphenyl)methyl]-2-hydroxybenzoate?
The canonical SMILES for dipotassium;5-[(3-carboxylato-4-hydroxyphenyl)methyl]-2-hydroxybenzoate is O=C([O-])c1cc(Cc2ccc(O)c(C(=O)[O-])c2)ccc1O.[K+].[K+].
What is the InChIKey of dipotassium;5-[(3-carboxylato-4-hydroxyphenyl)methyl]-2-hydroxybenzoate?
The InChIKey is HDRZHGSDUWMJSK-UHFFFAOYSA-L. The full InChI is InChI=1S/C15H12O6.2K/c16-12-3-1-8(6-10(12)14(18)19)5-9-2-4-13(17)11(7-9)15(20)21;;/h1-4,6-7,16-17H,5H2,(H,18,19)(H,20,21);;/q;2*+1/p-2.
What are the key properties of dipotassium;5-[(3-carboxylato-4-hydroxyphenyl)methyl]-2-hydroxybenzoate?
dipotassium;5-[(3-carboxylato-4-hydroxyphenyl)methyl]-2-hydroxybenzoate has a molecular weight of 364.44 g/mol, XLogP of -6.58, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dipotassium;5-[(3-carboxylato-4-hydroxyphenyl)methyl]-2-hydroxybenzoate is sourced from PubChem (CID 22945073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).