C15H10K2O6 — CID 22945073
dipotassium;5-[(3-carboxylato-4-hydroxyphenyl)methyl]-2-hydroxybenzoate (PubChem CID 22945073) has the molecular formula C15H10K2O6 and a molecular weight of 364.44 g/mol. Its IUPAC name is dipotassium;5-[(3-carboxylato-4-hydroxyphenyl)methyl]-2-hydroxybenzoate.
| Compound Name | dipotassium;5-[(3-carboxylato-4-hydroxyphenyl)methyl]-2-hydroxybenzoate |
|---|---|
| PubChem CID | 22945073 |
| Molecular Formula | C15H10K2O6 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 363.98 |
| IUPAC Name | dipotassium;5-[(3-carboxylato-4-hydroxyphenyl)methyl]-2-hydroxybenzoate |
| SMILES | O=C([O-])c1cc(Cc2ccc(O)c(C(=O)[O-])c2)ccc1O.[K+].[K+] |
| InChI | InChI=1S/C15H12O6.2K/c16-12-3-1-8(6-10(12)14(18)19)5-9-2-4-13(17)11(7-9)15(20)21;;/h1-4,6-7,16-17H,5H2,(H,18,19)(H,20,21);;/q;2*+1/p-2 |
| InChIKey | HDRZHGSDUWMJSK-UHFFFAOYSA-L |
| XLogP | -6.58 |
| TPSA | 120.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | -6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |