C20H28O3 — CID 91044178
ethane;1-[2-hydroxy-5-[(4-methoxyphenyl)methyl]phenyl]ethanone (PubChem CID 91044178) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is ethane;1-[2-hydroxy-5-[(4-methoxyphenyl)methyl]phenyl]ethanone.
| Compound Name | ethane;1-[2-hydroxy-5-[(4-methoxyphenyl)methyl]phenyl]ethanone |
|---|---|
| PubChem CID | 91044178 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | ethane;1-[2-hydroxy-5-[(4-methoxyphenyl)methyl]phenyl]ethanone |
| SMILES | CC.CC.COc1ccc(Cc2ccc(O)c(C(C)=O)c2)cc1 |
| InChI | InChI=1S/C16H16O3.2C2H6/c1-11(17)15-10-13(5-8-16(15)18)9-12-3-6-14(19-2)7-4-12;2*1-2/h3-8,10,18H,9H2,1-2H3;2*1-2H3 |
| InChIKey | SONHMZNAYVKIDN-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |