About cyclopropane;1-[2-hydroxy-5-[2-(4-methoxyphenyl)propan-2-yl]phenyl]ethanone
cyclopropane;1-[2-hydroxy-5-[2-(4-methoxyphenyl)propan-2-yl]phenyl]ethanone (PubChem CID 143878278) has the molecular formula C21H26O3
and a molecular weight of 326.44 g/mol. Its IUPAC name is cyclopropane;1-[2-hydroxy-5-[2-(4-methoxyphenyl)propan-2-yl]phenyl]ethanone.
Molecular Properties
| Compound Name | cyclopropane;1-[2-hydroxy-5-[2-(4-methoxyphenyl)propan-2-yl]phenyl]ethanone |
| PubChem CID | 143878278 |
| Molecular Formula | C21H26O3 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | cyclopropane;1-[2-hydroxy-5-[2-(4-methoxyphenyl)propan-2-yl]phenyl]ethanone |
| SMILES | C1CC1.COc1ccc(C(C)(C)c2ccc(O)c(C(C)=O)c2)cc1 |
| InChI | InChI=1S/C18H20O3.C3H6/c1-12(19)16-11-14(7-10-17(16)20)18(2,3)13-5-8-15(21-4)9-6-13;1-2-3-1/h5-11,20H,1-4H3;1-3H2 |
| InChIKey | VQAYKAYUDVKVCI-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclopropane;1-[2-hydroxy-5-[2-(4-methoxyphenyl)propan-2-yl]phenyl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropane;1-[2-hydroxy-5-[2-(4-methoxyphenyl)propan-2-yl]phenyl]ethanone?
The IUPAC name of cyclopropane;1-[2-hydroxy-5-[2-(4-methoxyphenyl)propan-2-yl]phenyl]ethanone (CID 143878278) is cyclopropane;1-[2-hydroxy-5-[2-(4-methoxyphenyl)propan-2-yl]phenyl]ethanone.
What is the SMILES notation for cyclopropane;1-[2-hydroxy-5-[2-(4-methoxyphenyl)propan-2-yl]phenyl]ethanone?
The canonical SMILES for cyclopropane;1-[2-hydroxy-5-[2-(4-methoxyphenyl)propan-2-yl]phenyl]ethanone is C1CC1.COc1ccc(C(C)(C)c2ccc(O)c(C(C)=O)c2)cc1.
What is the InChIKey of cyclopropane;1-[2-hydroxy-5-[2-(4-methoxyphenyl)propan-2-yl]phenyl]ethanone?
The InChIKey is VQAYKAYUDVKVCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20O3.C3H6/c1-12(19)16-11-14(7-10-17(16)20)18(2,3)13-5-8-15(21-4)9-6-13;1-2-3-1/h5-11,20H,1-4H3;1-3H2.
What are the key properties of cyclopropane;1-[2-hydroxy-5-[2-(4-methoxyphenyl)propan-2-yl]phenyl]ethanone?
cyclopropane;1-[2-hydroxy-5-[2-(4-methoxyphenyl)propan-2-yl]phenyl]ethanone has a molecular weight of 326.44 g/mol, XLogP of 5.10, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropane;1-[2-hydroxy-5-[2-(4-methoxyphenyl)propan-2-yl]phenyl]ethanone is sourced from PubChem (CID 143878278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).