C24H26Cl2N2O7S — CID 70036150
4-chloro-N-[5-[3-[[(1S)-3-(3-chloro-4-hydroxyphenyl)-1-hydroxypropyl]amino]-2-hydroxypropoxy]-2-hydroxyphenyl]benzenesulfonamide (PubChem CID 70036150) has the molecular formula C24H26Cl2N2O7S and a molecular weight of 557.45 g/mol. Its IUPAC name is 4-chloro-N-[5-[3-[[(1S)-3-(3-chloro-4-hydroxyphenyl)-1-hydroxypropyl]amino]-2-hydroxypropoxy]-2-hydroxyphenyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[5-[3-[[(1S)-3-(3-chloro-4-hydroxyphenyl)-1-hydroxypropyl]amino]-2-hydroxypropoxy]-2-hydroxyphenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 70036150 |
| Molecular Formula | C24H26Cl2N2O7S |
| Molecular Weight | 557.45 g/mol |
| Exact Mass | 556.08 |
| IUPAC Name | 4-chloro-N-[5-[3-[[(1S)-3-(3-chloro-4-hydroxyphenyl)-1-hydroxypropyl]amino]-2-hydroxypropoxy]-2-hydroxyphenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cc(OCC(O)CN[C@@H](O)CCc2ccc(O)c(Cl)c2)ccc1O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H26Cl2N2O7S/c25-16-3-6-19(7-4-16)36(33,34)28-21-12-18(5-9-23(21)31)35-14-17(29)13-27-24(32)10-2-15-1-8-22(30)20(26)11-15/h1,3-9,11-12,17,24,27-32H,2,10,13-14H2/t17?,24-/m0/s1 |
| InChIKey | JGMIHLRYIJEXHA-UCSBTNPJSA-N |
| XLogP | 3.49 |
| TPSA | 148.35 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.45 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|