C26H33N2O8PS — CID 56998172
[4-[(2R)-2-[[(2S)-2-hydroxy-3-[4-hydroxy-3-(methanesulfonamido)phenoxy]propyl]amino]propyl]phenyl]-(phenoxymethyl)phosphinic acid (PubChem CID 56998172) has the molecular formula C26H33N2O8PS and a molecular weight of 564.60 g/mol. Its IUPAC name is [4-[(2R)-2-[[(2S)-2-hydroxy-3-[4-hydroxy-3-(methanesulfonamido)phenoxy]propyl]amino]propyl]phenyl]-(phenoxymethyl)phosphinic acid.
| Compound Name | [4-[(2R)-2-[[(2S)-2-hydroxy-3-[4-hydroxy-3-(methanesulfonamido)phenoxy]propyl]amino]propyl]phenyl]-(phenoxymethyl)phosphinic acid |
|---|---|
| PubChem CID | 56998172 |
| Molecular Formula | C26H33N2O8PS |
| Molecular Weight | 564.60 g/mol |
| Exact Mass | 564.17 |
| IUPAC Name | [4-[(2R)-2-[[(2S)-2-hydroxy-3-[4-hydroxy-3-(methanesulfonamido)phenoxy]propyl]amino]propyl]phenyl]-(phenoxymethyl)phosphinic acid |
| SMILES | C[C@H](Cc1ccc(P(=O)(O)COc2ccccc2)cc1)NC[C@H](O)COc1ccc(O)c(NS(C)(=O)=O)c1 |
| InChI | InChI=1S/C26H33N2O8PS/c1-19(27-16-21(29)17-35-23-10-13-26(30)25(15-23)28-38(2,33)34)14-20-8-11-24(12-9-20)37(31,32)18-36-22-6-4-3-5-7-22/h3-13,15,19,21,27-30H,14,16-18H2,1-2H3,(H,31,32)/t19-,21+/m1/s1 |
| InChIKey | YQJCOWBJNPVPCM-CTNGQTDRSA-N |
| XLogP | 2.66 |
| TPSA | 154.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.60 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|