C35H50NO7PSi — CID 67683828
benzyl-[[4-[2-[[3-[(2,2-dibutyl-4H-1,3,2-benzodioxasilin-6-yl)oxy]-2-hydroxypropyl]amino]propyl]phenoxy]methyl]phosphinic acid (PubChem CID 67683828) has the molecular formula C35H50NO7PSi and a molecular weight of 655.85 g/mol. Its IUPAC name is benzyl-[[4-[2-[[3-[(2,2-dibutyl-4H-1,3,2-benzodioxasilin-6-yl)oxy]-2-hydroxypropyl]amino]propyl]phenoxy]methyl]phosphinic acid.
| Compound Name | benzyl-[[4-[2-[[3-[(2,2-dibutyl-4H-1,3,2-benzodioxasilin-6-yl)oxy]-2-hydroxypropyl]amino]propyl]phenoxy]methyl]phosphinic acid |
|---|---|
| PubChem CID | 67683828 |
| Molecular Formula | C35H50NO7PSi |
| Molecular Weight | 655.85 g/mol |
| Exact Mass | 655.31 |
| IUPAC Name | benzyl-[[4-[2-[[3-[(2,2-dibutyl-4H-1,3,2-benzodioxasilin-6-yl)oxy]-2-hydroxypropyl]amino]propyl]phenoxy]methyl]phosphinic acid |
| SMILES | CCCC[Si]1(CCCC)OCc2cc(OCC(O)CNC(C)Cc3ccc(OCP(=O)(O)Cc4ccccc4)cc3)ccc2O1 |
| InChI | InChI=1S/C35H50NO7PSi/c1-4-6-19-45(20-7-5-2)42-24-31-22-34(17-18-35(31)43-45)40-25-32(37)23-36-28(3)21-29-13-15-33(16-14-29)41-27-44(38,39)26-30-11-9-8-10-12-30/h8-18,22,28,32,36-37H,4-7,19-21,23-27H2,1-3H3,(H,38,39) |
| InChIKey | CXLIGBBRNSEOGS-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 106.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.85 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|