C25H30N2O5S — CID 22960390
N-[2-hydroxy-5-[2-hydroxy-3-[[1-(3-methoxyphenyl)-2-phenylethyl]amino]propyl]phenyl]methanesulfonamide (PubChem CID 22960390) has the molecular formula C25H30N2O5S and a molecular weight of 470.59 g/mol. Its IUPAC name is N-[2-hydroxy-5-[2-hydroxy-3-[[1-(3-methoxyphenyl)-2-phenylethyl]amino]propyl]phenyl]methanesulfonamide.
| Compound Name | N-[2-hydroxy-5-[2-hydroxy-3-[[1-(3-methoxyphenyl)-2-phenylethyl]amino]propyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 22960390 |
| Molecular Formula | C25H30N2O5S |
| Molecular Weight | 470.59 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | N-[2-hydroxy-5-[2-hydroxy-3-[[1-(3-methoxyphenyl)-2-phenylethyl]amino]propyl]phenyl]methanesulfonamide |
| SMILES | COc1cccc(C(Cc2ccccc2)NCC(O)Cc2ccc(O)c(NS(C)(=O)=O)c2)c1 |
| InChI | InChI=1S/C25H30N2O5S/c1-32-22-10-6-9-20(16-22)23(14-18-7-4-3-5-8-18)26-17-21(28)13-19-11-12-25(29)24(15-19)27-33(2,30)31/h3-12,15-16,21,23,26-29H,13-14,17H2,1-2H3 |
| InChIKey | RDRFEDNBEUPJBQ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.59 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|