C23H25FN2O4S — CID 11238318
N-[5-[(1R)-2-[[1-(4-fluorophenyl)-2-phenylethyl]amino]-1-hydroxyethyl]-2-hydroxyphenyl]methanesulfonamide (PubChem CID 11238318) has the molecular formula C23H25FN2O4S and a molecular weight of 444.53 g/mol. Its IUPAC name is N-[5-[(1R)-2-[[1-(4-fluorophenyl)-2-phenylethyl]amino]-1-hydroxyethyl]-2-hydroxyphenyl]methanesulfonamide.
| Compound Name | N-[5-[(1R)-2-[[1-(4-fluorophenyl)-2-phenylethyl]amino]-1-hydroxyethyl]-2-hydroxyphenyl]methanesulfonamide |
|---|---|
| PubChem CID | 11238318 |
| Molecular Formula | C23H25FN2O4S |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | N-[5-[(1R)-2-[[1-(4-fluorophenyl)-2-phenylethyl]amino]-1-hydroxyethyl]-2-hydroxyphenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cc([C@@H](O)CNC(Cc2ccccc2)c2ccc(F)cc2)ccc1O |
| InChI | InChI=1S/C23H25FN2O4S/c1-31(29,30)26-21-14-18(9-12-22(21)27)23(28)15-25-20(13-16-5-3-2-4-6-16)17-7-10-19(24)11-8-17/h2-12,14,20,23,25-28H,13,15H2,1H3/t20?,23-/m0/s1 |
| InChIKey | KZONKMZNBDBPBW-AKRCKQFNSA-N |
| XLogP | 3.51 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|