C29H37N3O5S — CID 69288808
2-[4-[(2R)-2-[[(2S)-2-hydroxy-2-[4-hydroxy-3-(methanesulfonamido)phenyl]ethyl]amino]propyl]phenyl]-N-(3-phenylpropyl)acetamide (PubChem CID 69288808) has the molecular formula C29H37N3O5S and a molecular weight of 539.70 g/mol. Its IUPAC name is 2-[4-[(2R)-2-[[(2S)-2-hydroxy-2-[4-hydroxy-3-(methanesulfonamido)phenyl]ethyl]amino]propyl]phenyl]-N-(3-phenylpropyl)acetamide.
| Compound Name | 2-[4-[(2R)-2-[[(2S)-2-hydroxy-2-[4-hydroxy-3-(methanesulfonamido)phenyl]ethyl]amino]propyl]phenyl]-N-(3-phenylpropyl)acetamide |
|---|---|
| PubChem CID | 69288808 |
| Molecular Formula | C29H37N3O5S |
| Molecular Weight | 539.70 g/mol |
| Exact Mass | 539.25 |
| IUPAC Name | 2-[4-[(2R)-2-[[(2S)-2-hydroxy-2-[4-hydroxy-3-(methanesulfonamido)phenyl]ethyl]amino]propyl]phenyl]-N-(3-phenylpropyl)acetamide |
| SMILES | C[C@H](Cc1ccc(CC(=O)NCCCc2ccccc2)cc1)NC[C@@H](O)c1ccc(O)c(NS(C)(=O)=O)c1 |
| InChI | InChI=1S/C29H37N3O5S/c1-21(31-20-28(34)25-14-15-27(33)26(19-25)32-38(2,36)37)17-23-10-12-24(13-11-23)18-29(35)30-16-6-9-22-7-4-3-5-8-22/h3-5,7-8,10-15,19,21,28,31-34H,6,9,16-18,20H2,1-2H3,(H,30,35)/t21-,28-/m1/s1 |
| InChIKey | YIGGOKWGFROGAB-LYZGTLIUSA-N |
| XLogP | 3.31 |
| TPSA | 127.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.70 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|