C43H41N2O7PS — CID 67702293
N-[5-[(2S)-3-[2-[4-[diphenyl(phosphoroso)methoxy]phenyl]ethylamino]-2-hydroxypropoxy]-2-phenylmethoxyphenyl]benzenesulfonamide (PubChem CID 67702293) has the molecular formula C43H41N2O7PS and a molecular weight of 760.85 g/mol. Its IUPAC name is N-[5-[(2S)-3-[2-[4-[diphenyl(phosphoroso)methoxy]phenyl]ethylamino]-2-hydroxypropoxy]-2-phenylmethoxyphenyl]benzenesulfonamide.
| Compound Name | N-[5-[(2S)-3-[2-[4-[diphenyl(phosphoroso)methoxy]phenyl]ethylamino]-2-hydroxypropoxy]-2-phenylmethoxyphenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 67702293 |
| Molecular Formula | C43H41N2O7PS |
| Molecular Weight | 760.85 g/mol |
| Exact Mass | 760.24 |
| IUPAC Name | N-[5-[(2S)-3-[2-[4-[diphenyl(phosphoroso)methoxy]phenyl]ethylamino]-2-hydroxypropoxy]-2-phenylmethoxyphenyl]benzenesulfonamide |
| SMILES | O=PC(Oc1ccc(CCNC[C@H](O)COc2ccc(OCc3ccccc3)c(NS(=O)(=O)c3ccccc3)c2)cc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C43H41N2O7PS/c46-37(30-44-28-27-33-21-23-38(24-22-33)52-43(53-47,35-15-7-2-8-16-35)36-17-9-3-10-18-36)32-50-39-25-26-42(51-31-34-13-5-1-6-14-34)41(29-39)45-54(48,49)40-19-11-4-12-20-40/h1-26,29,37,44-46H,27-28,30-32H2/t37-/m0/s1 |
| InChIKey | NAWSYAQQPVXAJS-QNGWXLTQSA-N |
| XLogP | 8.21 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.85 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|