C34H34N2O5S — CID 19384980
N-[4-[2-[[2-hydroxy-3-(2-phenylmethoxyphenoxy)propyl]amino]ethyl]phenyl]naphthalene-2-sulfonamide (PubChem CID 19384980) has the molecular formula C34H34N2O5S and a molecular weight of 582.72 g/mol. Its IUPAC name is N-[4-[2-[[2-hydroxy-3-(2-phenylmethoxyphenoxy)propyl]amino]ethyl]phenyl]naphthalene-2-sulfonamide.
| Compound Name | N-[4-[2-[[2-hydroxy-3-(2-phenylmethoxyphenoxy)propyl]amino]ethyl]phenyl]naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 19384980 |
| Molecular Formula | C34H34N2O5S |
| Molecular Weight | 582.72 g/mol |
| Exact Mass | 582.22 |
| IUPAC Name | N-[4-[2-[[2-hydroxy-3-(2-phenylmethoxyphenoxy)propyl]amino]ethyl]phenyl]naphthalene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(CCNCC(O)COc2ccccc2OCc2ccccc2)cc1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C34H34N2O5S/c37-31(25-41-34-13-7-6-12-33(34)40-24-27-8-2-1-3-9-27)23-35-21-20-26-14-17-30(18-15-26)36-42(38,39)32-19-16-28-10-4-5-11-29(28)22-32/h1-19,22,31,35-37H,20-21,23-25H2 |
| InChIKey | UCWMYACVTZHIPM-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.72 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|