C27H27N5O4S — CID 19384992
N-[4-[2-[[3-(4-amino-3-cyanophenoxy)-2-hydroxypropyl]amino]ethyl]phenyl]quinoline-3-sulfonamide (PubChem CID 19384992) has the molecular formula C27H27N5O4S and a molecular weight of 517.61 g/mol. Its IUPAC name is N-[4-[2-[[3-(4-amino-3-cyanophenoxy)-2-hydroxypropyl]amino]ethyl]phenyl]quinoline-3-sulfonamide.
| Compound Name | N-[4-[2-[[3-(4-amino-3-cyanophenoxy)-2-hydroxypropyl]amino]ethyl]phenyl]quinoline-3-sulfonamide |
|---|---|
| PubChem CID | 19384992 |
| Molecular Formula | C27H27N5O4S |
| Molecular Weight | 517.61 g/mol |
| Exact Mass | 517.18 |
| IUPAC Name | N-[4-[2-[[3-(4-amino-3-cyanophenoxy)-2-hydroxypropyl]amino]ethyl]phenyl]quinoline-3-sulfonamide |
| SMILES | N#Cc1cc(OCC(O)CNCCc2ccc(NS(=O)(=O)c3cnc4ccccc4c3)cc2)ccc1N |
| InChI | InChI=1S/C27H27N5O4S/c28-15-21-13-24(9-10-26(21)29)36-18-23(33)16-30-12-11-19-5-7-22(8-6-19)32-37(34,35)25-14-20-3-1-2-4-27(20)31-17-25/h1-10,13-14,17,23,30,32-33H,11-12,16,18,29H2 |
| InChIKey | NHRGQKNRPMOPPW-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 150.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.61 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|