C22H22F3NO2 — CID 2478160
(2R)-1-naphthalen-2-yloxy-3-[2-[4-(trifluoromethyl)phenyl]ethylamino]propan-2-ol (PubChem CID 2478160) has the molecular formula C22H22F3NO2 and a molecular weight of 389.42 g/mol. Its IUPAC name is (2R)-1-naphthalen-2-yloxy-3-[2-[4-(trifluoromethyl)phenyl]ethylamino]propan-2-ol.
| Compound Name | (2R)-1-naphthalen-2-yloxy-3-[2-[4-(trifluoromethyl)phenyl]ethylamino]propan-2-ol |
|---|---|
| PubChem CID | 2478160 |
| Molecular Formula | C22H22F3NO2 |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | (2R)-1-naphthalen-2-yloxy-3-[2-[4-(trifluoromethyl)phenyl]ethylamino]propan-2-ol |
| SMILES | O[C@H](CNCCc1ccc(C(F)(F)F)cc1)COc1ccc2ccccc2c1 |
| InChI | InChI=1S/C22H22F3NO2/c23-22(24,25)19-8-5-16(6-9-19)11-12-26-14-20(27)15-28-21-10-7-17-3-1-2-4-18(17)13-21/h1-10,13,20,26-27H,11-12,14-15H2/t20-/m1/s1 |
| InChIKey | ZVBOWQHDIGYEQB-HXUWFJFHSA-N |
| XLogP | 4.43 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|