C40H43N2O7PS — CID 57220652
N-[5-[3-[2-[4-[diphenyl(phosphoroso)methoxy]phenyl]ethylamino]-2-hydroxypropoxy]-2-phenylmethoxyphenyl]propane-2-sulfonamide (PubChem CID 57220652) has the molecular formula C40H43N2O7PS and a molecular weight of 726.83 g/mol. Its IUPAC name is N-[5-[3-[2-[4-[diphenyl(phosphoroso)methoxy]phenyl]ethylamino]-2-hydroxypropoxy]-2-phenylmethoxyphenyl]propane-2-sulfonamide.
| Compound Name | N-[5-[3-[2-[4-[diphenyl(phosphoroso)methoxy]phenyl]ethylamino]-2-hydroxypropoxy]-2-phenylmethoxyphenyl]propane-2-sulfonamide |
|---|---|
| PubChem CID | 57220652 |
| Molecular Formula | C40H43N2O7PS |
| Molecular Weight | 726.83 g/mol |
| Exact Mass | 726.25 |
| IUPAC Name | N-[5-[3-[2-[4-[diphenyl(phosphoroso)methoxy]phenyl]ethylamino]-2-hydroxypropoxy]-2-phenylmethoxyphenyl]propane-2-sulfonamide |
| SMILES | CC(C)S(=O)(=O)Nc1cc(OCC(O)CNCCc2ccc(OC(P=O)(c3ccccc3)c3ccccc3)cc2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C40H43N2O7PS/c1-30(2)51(45,46)42-38-26-37(22-23-39(38)48-28-32-12-6-3-7-13-32)47-29-35(43)27-41-25-24-31-18-20-36(21-19-31)49-40(50-44,33-14-8-4-9-15-33)34-16-10-5-11-17-34/h3-23,26,30,35,41-43H,24-25,27-29H2,1-2H3 |
| InChIKey | WAQXUWFDBSRURC-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.83 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|