C30H36N2O7S — CID 66648411
N-[5-[(2R)-3-(2,3,6,7,8,9-hexahydrobenzo[g][1,4]benzodioxin-7-ylmethylamino)-2-hydroxypropoxy]-2-phenylmethoxyphenyl]methanesulfonamide (PubChem CID 66648411) has the molecular formula C30H36N2O7S and a molecular weight of 568.69 g/mol. Its IUPAC name is N-[5-[(2R)-3-(2,3,6,7,8,9-hexahydrobenzo[g][1,4]benzodioxin-7-ylmethylamino)-2-hydroxypropoxy]-2-phenylmethoxyphenyl]methanesulfonamide.
| Compound Name | N-[5-[(2R)-3-(2,3,6,7,8,9-hexahydrobenzo[g][1,4]benzodioxin-7-ylmethylamino)-2-hydroxypropoxy]-2-phenylmethoxyphenyl]methanesulfonamide |
|---|---|
| PubChem CID | 66648411 |
| Molecular Formula | C30H36N2O7S |
| Molecular Weight | 568.69 g/mol |
| Exact Mass | 568.22 |
| IUPAC Name | N-[5-[(2R)-3-(2,3,6,7,8,9-hexahydrobenzo[g][1,4]benzodioxin-7-ylmethylamino)-2-hydroxypropoxy]-2-phenylmethoxyphenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cc(OC[C@H](O)CNCC2CCc3cc4c(cc3C2)OCCO4)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C30H36N2O7S/c1-40(34,35)32-27-16-26(9-10-28(27)39-19-21-5-3-2-4-6-21)38-20-25(33)18-31-17-22-7-8-23-14-29-30(15-24(23)13-22)37-12-11-36-29/h2-6,9-10,14-16,22,25,31-33H,7-8,11-13,17-20H2,1H3/t22?,25-/m1/s1 |
| InChIKey | MEWDLVLWGKFYDK-NRWPOFLRSA-N |
| XLogP | 3.54 |
| TPSA | 115.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.69 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |