C33H33N3O5S — CID 19384987
N-[4-[2-[[2-hydroxy-3-(2-phenylmethoxyphenoxy)propyl]amino]ethyl]phenyl]quinoline-8-sulfonamide (PubChem CID 19384987) has the molecular formula C33H33N3O5S and a molecular weight of 583.71 g/mol. Its IUPAC name is N-[4-[2-[[2-hydroxy-3-(2-phenylmethoxyphenoxy)propyl]amino]ethyl]phenyl]quinoline-8-sulfonamide.
| Compound Name | N-[4-[2-[[2-hydroxy-3-(2-phenylmethoxyphenoxy)propyl]amino]ethyl]phenyl]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 19384987 |
| Molecular Formula | C33H33N3O5S |
| Molecular Weight | 583.71 g/mol |
| Exact Mass | 583.21 |
| IUPAC Name | N-[4-[2-[[2-hydroxy-3-(2-phenylmethoxyphenoxy)propyl]amino]ethyl]phenyl]quinoline-8-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(CCNCC(O)COc2ccccc2OCc2ccccc2)cc1)c1cccc2cccnc12 |
| InChI | InChI=1S/C33H33N3O5S/c37-29(24-41-31-13-5-4-12-30(31)40-23-26-8-2-1-3-9-26)22-34-21-19-25-15-17-28(18-16-25)36-42(38,39)32-14-6-10-27-11-7-20-35-33(27)32/h1-18,20,29,34,36-37H,19,21-24H2 |
| InChIKey | XOBFCQBZBVXOMA-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 109.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.71 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|