C22H25ClN2O4 — CID 24843477
1-[2-[(4-chloro-3-methyl-1,2-oxazol-5-yl)methoxy]phenoxy]-3-(2-phenylethylamino)propan-2-ol (PubChem CID 24843477) has the molecular formula C22H25ClN2O4 and a molecular weight of 416.91 g/mol. Its IUPAC name is 1-[2-[(4-chloro-3-methyl-1,2-oxazol-5-yl)methoxy]phenoxy]-3-(2-phenylethylamino)propan-2-ol.
| Compound Name | 1-[2-[(4-chloro-3-methyl-1,2-oxazol-5-yl)methoxy]phenoxy]-3-(2-phenylethylamino)propan-2-ol |
|---|---|
| PubChem CID | 24843477 |
| Molecular Formula | C22H25ClN2O4 |
| Molecular Weight | 416.91 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | 1-[2-[(4-chloro-3-methyl-1,2-oxazol-5-yl)methoxy]phenoxy]-3-(2-phenylethylamino)propan-2-ol |
| SMILES | Cc1noc(COc2ccccc2OCC(O)CNCCc2ccccc2)c1Cl |
| InChI | InChI=1S/C22H25ClN2O4/c1-16-22(23)21(29-25-16)15-28-20-10-6-5-9-19(20)27-14-18(26)13-24-12-11-17-7-3-2-4-8-17/h2-10,18,24,26H,11-15H2,1H3 |
| InChIKey | GPZMVBWAIYBXEI-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 76.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.91 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|