C17H23N3O5S — CID 12681876
4-[2-hydroxy-3-[2-(phenylsulfamoylamino)ethylamino]propoxy]phenol (PubChem CID 12681876) has the molecular formula C17H23N3O5S and a molecular weight of 381.45 g/mol. Its IUPAC name is 4-[2-hydroxy-3-[2-(phenylsulfamoylamino)ethylamino]propoxy]phenol.
| Compound Name | 4-[2-hydroxy-3-[2-(phenylsulfamoylamino)ethylamino]propoxy]phenol |
|---|---|
| PubChem CID | 12681876 |
| Molecular Formula | C17H23N3O5S |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | 4-[2-hydroxy-3-[2-(phenylsulfamoylamino)ethylamino]propoxy]phenol |
| SMILES | O=S(=O)(NCCNCC(O)COc1ccc(O)cc1)Nc1ccccc1 |
| InChI | InChI=1S/C17H23N3O5S/c21-15-6-8-17(9-7-15)25-13-16(22)12-18-10-11-19-26(23,24)20-14-4-2-1-3-5-14/h1-9,16,18-22H,10-13H2 |
| InChIKey | TURKSFWGCCTQCE-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 119.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|