C13H23N3O5S — CID 12681869
1-[3-[2-(dimethylsulfamoylamino)ethylamino]-2-hydroxypropoxy]-4-hydroxybenzene (PubChem CID 12681869) has the molecular formula C13H23N3O5S and a molecular weight of 333.41 g/mol. Its IUPAC name is 1-[3-[2-(dimethylsulfamoylamino)ethylamino]-2-hydroxypropoxy]-4-hydroxybenzene.
| Compound Name | 1-[3-[2-(dimethylsulfamoylamino)ethylamino]-2-hydroxypropoxy]-4-hydroxybenzene |
|---|---|
| PubChem CID | 12681869 |
| Molecular Formula | C13H23N3O5S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | 1-[3-[2-(dimethylsulfamoylamino)ethylamino]-2-hydroxypropoxy]-4-hydroxybenzene |
| SMILES | CN(C)S(=O)(=O)NCCNCC(O)COc1ccc(O)cc1 |
| InChI | InChI=1S/C13H23N3O5S/c1-16(2)22(19,20)15-8-7-14-9-12(18)10-21-13-5-3-11(17)4-6-13/h3-6,12,14-15,17-18H,7-10H2,1-2H3 |
| InChIKey | BJECEWJIXVBYJX-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|