C27H30N2O5 — CID 18979124
[[7-(3-methyl-1,4-dioxonaphthalen-2-yl)-7-phenylheptanoyl]amino] N-ethylcarbamate (PubChem CID 18979124) has the molecular formula C27H30N2O5 and a molecular weight of 462.55 g/mol. Its IUPAC name is [[7-(3-methyl-1,4-dioxonaphthalen-2-yl)-7-phenylheptanoyl]amino] N-ethylcarbamate.
| Compound Name | [[7-(3-methyl-1,4-dioxonaphthalen-2-yl)-7-phenylheptanoyl]amino] N-ethylcarbamate |
|---|---|
| PubChem CID | 18979124 |
| Molecular Formula | C27H30N2O5 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | [[7-(3-methyl-1,4-dioxonaphthalen-2-yl)-7-phenylheptanoyl]amino] N-ethylcarbamate |
| SMILES | CCNC(=O)ONC(=O)CCCCCC(C1=C(C)C(=O)c2ccccc2C1=O)c1ccccc1 |
| InChI | InChI=1S/C27H30N2O5/c1-3-28-27(33)34-29-23(30)17-9-5-8-14-20(19-12-6-4-7-13-19)24-18(2)25(31)21-15-10-11-16-22(21)26(24)32/h4,6-7,10-13,15-16,20H,3,5,8-9,14,17H2,1-2H3,(H,28,33)(H,29,30) |
| InChIKey | AITVVRWWJYTALA-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|