C22H24N2O6 — CID 569846
[[8-(benzoyloxyamino)-8-oxooctanoyl]amino] benzoate (PubChem CID 569846) has the molecular formula C22H24N2O6 and a molecular weight of 412.44 g/mol. Its IUPAC name is [[8-(benzoyloxyamino)-8-oxooctanoyl]amino] benzoate.
| Compound Name | [[8-(benzoyloxyamino)-8-oxooctanoyl]amino] benzoate |
|---|---|
| PubChem CID | 569846 |
| Molecular Formula | C22H24N2O6 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | [[8-(benzoyloxyamino)-8-oxooctanoyl]amino] benzoate |
| SMILES | O=C(CCCCCCC(=O)NOC(=O)c1ccccc1)NOC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H24N2O6/c25-19(23-29-21(27)17-11-5-3-6-12-17)15-9-1-2-10-16-20(26)24-30-22(28)18-13-7-4-8-14-18/h3-8,11-14H,1-2,9-10,15-16H2,(H,23,25)(H,24,26) |
| InChIKey | PGGKLQYJCJJCSH-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|