C24H25NO3 — CID 18979137
(7-naphthalen-1-ylheptanoylamino) benzoate (PubChem CID 18979137) has the molecular formula C24H25NO3 and a molecular weight of 375.47 g/mol. Its IUPAC name is (7-naphthalen-1-ylheptanoylamino) benzoate.
| Compound Name | (7-naphthalen-1-ylheptanoylamino) benzoate |
|---|---|
| PubChem CID | 18979137 |
| Molecular Formula | C24H25NO3 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | (7-naphthalen-1-ylheptanoylamino) benzoate |
| SMILES | O=C(CCCCCCc1cccc2ccccc12)NOC(=O)c1ccccc1 |
| InChI | InChI=1S/C24H25NO3/c26-23(25-28-24(27)21-13-5-3-6-14-21)18-7-2-1-4-11-19-15-10-16-20-12-8-9-17-22(19)20/h3,5-6,8-10,12-17H,1-2,4,7,11,18H2,(H,25,26) |
| InChIKey | XQGDYWVULSDGFJ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|