C19H23NO4 — CID 68734772
(2S)-2-(6-hydroxyhexanoylamino)-3-naphthalen-1-ylpropanoic acid (PubChem CID 68734772) has the molecular formula C19H23NO4 and a molecular weight of 329.40 g/mol. Its IUPAC name is (2S)-2-(6-hydroxyhexanoylamino)-3-naphthalen-1-ylpropanoic acid.
| Compound Name | (2S)-2-(6-hydroxyhexanoylamino)-3-naphthalen-1-ylpropanoic acid |
|---|---|
| PubChem CID | 68734772 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | (2S)-2-(6-hydroxyhexanoylamino)-3-naphthalen-1-ylpropanoic acid |
| SMILES | O=C(CCCCCO)N[C@@H](Cc1cccc2ccccc12)C(=O)O |
| InChI | InChI=1S/C19H23NO4/c21-12-5-1-2-11-18(22)20-17(19(23)24)13-15-9-6-8-14-7-3-4-10-16(14)15/h3-4,6-10,17,21H,1-2,5,11-13H2,(H,20,22)(H,23,24)/t17-/m0/s1 |
| InChIKey | LPEMWKPWWQVNFJ-KRWDZBQOSA-N |
| XLogP | 2.50 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|