C23H27NO7 — CID 86304534
4-nitrooxybutyl 4-phenyl-4-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)butanoate (PubChem CID 86304534) has the molecular formula C23H27NO7 and a molecular weight of 429.47 g/mol. Its IUPAC name is 4-nitrooxybutyl 4-phenyl-4-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)butanoate.
| Compound Name | 4-nitrooxybutyl 4-phenyl-4-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)butanoate |
|---|---|
| PubChem CID | 86304534 |
| Molecular Formula | C23H27NO7 |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | 4-nitrooxybutyl 4-phenyl-4-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)butanoate |
| SMILES | CC1=C(C)C(=O)C(C(CCC(=O)OCCCCO[N+](=O)[O-])c2ccccc2)=C(C)C1=O |
| InChI | InChI=1S/C23H27NO7/c1-15-16(2)23(27)21(17(3)22(15)26)19(18-9-5-4-6-10-18)11-12-20(25)30-13-7-8-14-31-24(28)29/h4-6,9-10,19H,7-8,11-14H2,1-3H3 |
| InChIKey | FCVPXWCTLIUWQL-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 112.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|