C20H29NO7 — CID 86304386
6-nitrooxyhexyl 3-methyl-3-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)butanoate (PubChem CID 86304386) has the molecular formula C20H29NO7 and a molecular weight of 395.45 g/mol. Its IUPAC name is 6-nitrooxyhexyl 3-methyl-3-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)butanoate.
| Compound Name | 6-nitrooxyhexyl 3-methyl-3-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)butanoate |
|---|---|
| PubChem CID | 86304386 |
| Molecular Formula | C20H29NO7 |
| Molecular Weight | 395.45 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | 6-nitrooxyhexyl 3-methyl-3-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)butanoate |
| SMILES | CC1=C(C)C(=O)C(C(C)(C)CC(=O)OCCCCCCO[N+](=O)[O-])=C(C)C1=O |
| InChI | InChI=1S/C20H29NO7/c1-13-14(2)19(24)17(15(3)18(13)23)20(4,5)12-16(22)27-10-8-6-7-9-11-28-21(25)26/h6-12H2,1-5H3 |
| InChIKey | AXFXYDSSESJZFA-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 112.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.45 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|