C20H30N2O8 — CID 129018304
(6-aminooxy-5-nitrooxyhexyl) 3-methyl-3-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)butanoate (PubChem CID 129018304) has the molecular formula C20H30N2O8 and a molecular weight of 426.47 g/mol. Its IUPAC name is (6-aminooxy-5-nitrooxyhexyl) 3-methyl-3-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)butanoate.
| Compound Name | (6-aminooxy-5-nitrooxyhexyl) 3-methyl-3-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)butanoate |
|---|---|
| PubChem CID | 129018304 |
| Molecular Formula | C20H30N2O8 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | (6-aminooxy-5-nitrooxyhexyl) 3-methyl-3-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)butanoate |
| SMILES | CC1=C(C)C(=O)C(C(C)(C)CC(=O)OCCCCC(CON)O[N+](=O)[O-])=C(C)C1=O |
| InChI | InChI=1S/C20H30N2O8/c1-12-13(2)19(25)17(14(3)18(12)24)20(4,5)10-16(23)28-9-7-6-8-15(11-29-21)30-22(26)27/h15H,6-11,21H2,1-5H3 |
| InChIKey | WVMMWKAHIBBAJZ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 148.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|