About undecan-6-yl nitrate
undecan-6-yl nitrate (PubChem CID 91750842) has the molecular formula C11H23NO3
and a molecular weight of 217.31 g/mol. Its IUPAC name is undecan-6-yl nitrate.
Molecular Properties
| Compound Name | undecan-6-yl nitrate |
| PubChem CID | 91750842 |
| Molecular Formula | C11H23NO3 |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.17 |
| IUPAC Name | undecan-6-yl nitrate |
| SMILES | CCCCCC(CCCCC)O[N+](=O)[O-] |
| InChI | InChI=1S/C11H23NO3/c1-3-5-7-9-11(15-12(13)14)10-8-6-4-2/h11H,3-10H2,1-2H3 |
| InChIKey | QKIRWTVGFDYQDE-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze undecan-6-yl nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of undecan-6-yl nitrate?
The IUPAC name of undecan-6-yl nitrate (CID 91750842) is undecan-6-yl nitrate.
What is the SMILES notation for undecan-6-yl nitrate?
The canonical SMILES for undecan-6-yl nitrate is CCCCCC(CCCCC)O[N+](=O)[O-].
What is the InChIKey of undecan-6-yl nitrate?
The InChIKey is QKIRWTVGFDYQDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO3/c1-3-5-7-9-11(15-12(13)14)10-8-6-4-2/h11H,3-10H2,1-2H3.
What are the key properties of undecan-6-yl nitrate?
undecan-6-yl nitrate has a molecular weight of 217.31 g/mol, XLogP of 3.72, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for undecan-6-yl nitrate is sourced from PubChem (CID 91750842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).