About 1-aminooctadecyl nitrate
1-aminooctadecyl nitrate (PubChem CID 174904114) has the molecular formula C18H38N2O3
and a molecular weight of 330.51 g/mol. Its IUPAC name is 1-aminooctadecyl nitrate.
Molecular Properties
| Compound Name | 1-aminooctadecyl nitrate |
| PubChem CID | 174904114 |
| Molecular Formula | C18H38N2O3 |
| Molecular Weight | 330.51 g/mol |
| Exact Mass | 330.29 |
| IUPAC Name | 1-aminooctadecyl nitrate |
| SMILES | CCCCCCCCCCCCCCCCCC(N)O[N+](=O)[O-] |
| InChI | InChI=1S/C18H38N2O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)23-20(21)22/h18H,2-17,19H2,1H3 |
| InChIKey | LIEDRYROAWFNSD-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 330.51 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-aminooctadecyl nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminooctadecyl nitrate?
The IUPAC name of 1-aminooctadecyl nitrate (CID 174904114) is 1-aminooctadecyl nitrate.
What is the SMILES notation for 1-aminooctadecyl nitrate?
The canonical SMILES for 1-aminooctadecyl nitrate is CCCCCCCCCCCCCCCCCC(N)O[N+](=O)[O-].
What is the InChIKey of 1-aminooctadecyl nitrate?
The InChIKey is LIEDRYROAWFNSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H38N2O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)23-20(21)22/h18H,2-17,19H2,1H3.
What are the key properties of 1-aminooctadecyl nitrate?
1-aminooctadecyl nitrate has a molecular weight of 330.51 g/mol, XLogP of 5.74, 18 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminooctadecyl nitrate is sourced from PubChem (CID 174904114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).