About 1-aminododecyl nitrate
1-aminododecyl nitrate (PubChem CID 174374802) has the molecular formula C12H26N2O3
and a molecular weight of 246.35 g/mol. Its IUPAC name is 1-aminododecyl nitrate.
Molecular Properties
| Compound Name | 1-aminododecyl nitrate |
| PubChem CID | 174374802 |
| Molecular Formula | C12H26N2O3 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.19 |
| IUPAC Name | 1-aminododecyl nitrate |
| SMILES | CCCCCCCCCCCC(N)O[N+](=O)[O-] |
| InChI | InChI=1S/C12H26N2O3/c1-2-3-4-5-6-7-8-9-10-11-12(13)17-14(15)16/h12H,2-11,13H2,1H3 |
| InChIKey | IWEAJFNWJAWQIL-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-aminododecyl nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminododecyl nitrate?
The IUPAC name of 1-aminododecyl nitrate (CID 174374802) is 1-aminododecyl nitrate.
What is the SMILES notation for 1-aminododecyl nitrate?
The canonical SMILES for 1-aminododecyl nitrate is CCCCCCCCCCCC(N)O[N+](=O)[O-].
What is the InChIKey of 1-aminododecyl nitrate?
The InChIKey is IWEAJFNWJAWQIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26N2O3/c1-2-3-4-5-6-7-8-9-10-11-12(13)17-14(15)16/h12H,2-11,13H2,1H3.
What are the key properties of 1-aminododecyl nitrate?
1-aminododecyl nitrate has a molecular weight of 246.35 g/mol, XLogP of 3.40, 12 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminododecyl nitrate is sourced from PubChem (CID 174374802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).