About 1-iodooctyl nitrate
1-iodooctyl nitrate (PubChem CID 87604424) has the molecular formula C8H16INO3
and a molecular weight of 301.12 g/mol. Its IUPAC name is 1-iodooctyl nitrate.
Molecular Properties
| Compound Name | 1-iodooctyl nitrate |
| PubChem CID | 87604424 |
| Molecular Formula | C8H16INO3 |
| Molecular Weight | 301.12 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | 1-iodooctyl nitrate |
| SMILES | CCCCCCCC(I)O[N+](=O)[O-] |
| InChI | InChI=1S/C8H16INO3/c1-2-3-4-5-6-7-8(9)13-10(11)12/h8H,2-7H2,1H3 |
| InChIKey | ADGQYLTXQGQSLC-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.12 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-iodooctyl nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-iodooctyl nitrate?
The IUPAC name of 1-iodooctyl nitrate (CID 87604424) is 1-iodooctyl nitrate.
What is the SMILES notation for 1-iodooctyl nitrate?
The canonical SMILES for 1-iodooctyl nitrate is CCCCCCCC(I)O[N+](=O)[O-].
What is the InChIKey of 1-iodooctyl nitrate?
The InChIKey is ADGQYLTXQGQSLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16INO3/c1-2-3-4-5-6-7-8(9)13-10(11)12/h8H,2-7H2,1H3.
What are the key properties of 1-iodooctyl nitrate?
1-iodooctyl nitrate has a molecular weight of 301.12 g/mol, XLogP of 3.32, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-iodooctyl nitrate is sourced from PubChem (CID 87604424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).