About 1,2-dihydroxyundecan-3-yl nitrate
1,2-dihydroxyundecan-3-yl nitrate (PubChem CID 15167145) has the molecular formula C11H23NO5
and a molecular weight of 249.31 g/mol. Its IUPAC name is 1,2-dihydroxyundecan-3-yl nitrate.
Molecular Properties
| Compound Name | 1,2-dihydroxyundecan-3-yl nitrate |
| PubChem CID | 15167145 |
| Molecular Formula | C11H23NO5 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.16 |
| IUPAC Name | 1,2-dihydroxyundecan-3-yl nitrate |
| SMILES | CCCCCCCCC(O[N+](=O)[O-])C(O)CO |
| InChI | InChI=1S/C11H23NO5/c1-2-3-4-5-6-7-8-11(10(14)9-13)17-12(15)16/h10-11,13-14H,2-9H2,1H3 |
| InChIKey | IKKYDMYDMGBBFE-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dihydroxyundecan-3-yl nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dihydroxyundecan-3-yl nitrate?
The IUPAC name of 1,2-dihydroxyundecan-3-yl nitrate (CID 15167145) is 1,2-dihydroxyundecan-3-yl nitrate.
What is the SMILES notation for 1,2-dihydroxyundecan-3-yl nitrate?
The canonical SMILES for 1,2-dihydroxyundecan-3-yl nitrate is CCCCCCCCC(O[N+](=O)[O-])C(O)CO.
What is the InChIKey of 1,2-dihydroxyundecan-3-yl nitrate?
The InChIKey is IKKYDMYDMGBBFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO5/c1-2-3-4-5-6-7-8-11(10(14)9-13)17-12(15)16/h10-11,13-14H,2-9H2,1H3.
What are the key properties of 1,2-dihydroxyundecan-3-yl nitrate?
1,2-dihydroxyundecan-3-yl nitrate has a molecular weight of 249.31 g/mol, XLogP of 1.67, 11 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dihydroxyundecan-3-yl nitrate is sourced from PubChem (CID 15167145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).