About 2-nitrooxyhexanoic acid
2-nitrooxyhexanoic acid (PubChem CID 13130235) has the molecular formula C6H11NO5
and a molecular weight of 177.16 g/mol. Its IUPAC name is 2-nitrooxyhexanoic acid.
Molecular Properties
| Compound Name | 2-nitrooxyhexanoic acid |
| PubChem CID | 13130235 |
| Molecular Formula | C6H11NO5 |
| Molecular Weight | 177.16 g/mol |
| Exact Mass | 177.06 |
| IUPAC Name | 2-nitrooxyhexanoic acid |
| SMILES | CCCCC(O[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C6H11NO5/c1-2-3-4-5(6(8)9)12-7(10)11/h5H,2-4H2,1H3,(H,8,9) |
| InChIKey | JEDGAPUZBUOYQF-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.16 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-nitrooxyhexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitrooxyhexanoic acid?
The IUPAC name of 2-nitrooxyhexanoic acid (CID 13130235) is 2-nitrooxyhexanoic acid.
What is the SMILES notation for 2-nitrooxyhexanoic acid?
The canonical SMILES for 2-nitrooxyhexanoic acid is CCCCC(O[N+](=O)[O-])C(=O)O.
What is the InChIKey of 2-nitrooxyhexanoic acid?
The InChIKey is JEDGAPUZBUOYQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO5/c1-2-3-4-5(6(8)9)12-7(10)11/h5H,2-4H2,1H3,(H,8,9).
What are the key properties of 2-nitrooxyhexanoic acid?
2-nitrooxyhexanoic acid has a molecular weight of 177.16 g/mol, XLogP of 0.84, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitrooxyhexanoic acid is sourced from PubChem (CID 13130235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).