C28H44O7Si — CID 20742526
3-[tert-butyl(dimethyl)silyl]oxypropyl 3-[2,5-dimethyl-3,6-dioxo-4-(3-oxo-3-prop-2-enoxypropyl)cyclohexa-1,4-dien-1-yl]-3-methylbutanoate (PubChem CID 20742526) has the molecular formula C28H44O7Si and a molecular weight of 520.74 g/mol. Its IUPAC name is 3-[tert-butyl(dimethyl)silyl]oxypropyl 3-[2,5-dimethyl-3,6-dioxo-4-(3-oxo-3-prop-2-enoxypropyl)cyclohexa-1,4-dien-1-yl]-3-methylbutanoate.
| Compound Name | 3-[tert-butyl(dimethyl)silyl]oxypropyl 3-[2,5-dimethyl-3,6-dioxo-4-(3-oxo-3-prop-2-enoxypropyl)cyclohexa-1,4-dien-1-yl]-3-methylbutanoate |
|---|---|
| PubChem CID | 20742526 |
| Molecular Formula | C28H44O7Si |
| Molecular Weight | 520.74 g/mol |
| Exact Mass | 520.29 |
| IUPAC Name | 3-[tert-butyl(dimethyl)silyl]oxypropyl 3-[2,5-dimethyl-3,6-dioxo-4-(3-oxo-3-prop-2-enoxypropyl)cyclohexa-1,4-dien-1-yl]-3-methylbutanoate |
| SMILES | C=CCOC(=O)CCC1=C(C)C(=O)C(C(C)(C)CC(=O)OCCCO[Si](C)(C)C(C)(C)C)=C(C)C1=O |
| InChI | InChI=1S/C28H44O7Si/c1-11-15-33-22(29)14-13-21-19(2)26(32)24(20(3)25(21)31)28(7,8)18-23(30)34-16-12-17-35-36(9,10)27(4,5)6/h11H,1,12-18H2,2-10H3 |
| InChIKey | LYPLTWLQTGVMJY-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.74 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|