C23H28O4 — CID 15229494
8-phenyl-8-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)octanoic acid (PubChem CID 15229494) has the molecular formula C23H28O4 and a molecular weight of 368.47 g/mol. Its IUPAC name is 8-phenyl-8-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)octanoic acid.
| Compound Name | 8-phenyl-8-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)octanoic acid |
|---|---|
| PubChem CID | 15229494 |
| Molecular Formula | C23H28O4 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | 8-phenyl-8-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)octanoic acid |
| SMILES | CC1=C(C)C(=O)C(C(CCCCCCC(=O)O)c2ccccc2)=C(C)C1=O |
| InChI | InChI=1S/C23H28O4/c1-15-16(2)23(27)21(17(3)22(15)26)19(18-11-7-6-8-12-18)13-9-4-5-10-14-20(24)25/h6-8,11-12,19H,4-5,9-10,13-14H2,1-3H3,(H,24,25) |
| InChIKey | ATNMGQDSLXGYGL-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|