C28H27NO6 — CID 139664958
(4-nitrophenyl) 7-phenyl-7-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)hept-2-enoate (PubChem CID 139664958) has the molecular formula C28H27NO6 and a molecular weight of 473.53 g/mol. Its IUPAC name is (4-nitrophenyl) 7-phenyl-7-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)hept-2-enoate.
| Compound Name | (4-nitrophenyl) 7-phenyl-7-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)hept-2-enoate |
|---|---|
| PubChem CID | 139664958 |
| Molecular Formula | C28H27NO6 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | (4-nitrophenyl) 7-phenyl-7-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)hept-2-enoate |
| SMILES | CC1=C(C)C(=O)C(C(CCCC=CC(=O)Oc2ccc([N+](=O)[O-])cc2)c2ccccc2)=C(C)C1=O |
| InChI | InChI=1S/C28H27NO6/c1-18-19(2)28(32)26(20(3)27(18)31)24(21-10-6-4-7-11-21)12-8-5-9-13-25(30)35-23-16-14-22(15-17-23)29(33)34/h4,6-7,9-11,13-17,24H,5,8,12H2,1-3H3 |
| InChIKey | KSPUXBNTTQPZKR-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 103.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|