C24H25NO5 — CID 142457343
benzene;methyl 2-[4-(3-methyl-1,4-dioxonaphthalen-2-yl)butanoylamino]acetate (PubChem CID 142457343) has the molecular formula C24H25NO5 and a molecular weight of 407.47 g/mol. Its IUPAC name is benzene;methyl 2-[4-(3-methyl-1,4-dioxonaphthalen-2-yl)butanoylamino]acetate.
| Compound Name | benzene;methyl 2-[4-(3-methyl-1,4-dioxonaphthalen-2-yl)butanoylamino]acetate |
|---|---|
| PubChem CID | 142457343 |
| Molecular Formula | C24H25NO5 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | benzene;methyl 2-[4-(3-methyl-1,4-dioxonaphthalen-2-yl)butanoylamino]acetate |
| SMILES | COC(=O)CNC(=O)CCCC1=C(C)C(=O)c2ccccc2C1=O.c1ccccc1 |
| InChI | InChI=1S/C18H19NO5.C6H6/c1-11-12(8-5-9-15(20)19-10-16(21)24-2)18(23)14-7-4-3-6-13(14)17(11)22;1-2-4-6-5-3-1/h3-4,6-7H,5,8-10H2,1-2H3,(H,19,20);1-6H |
| InChIKey | HOOPCBJXIQBHNS-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|