About 2-amino-N-[(3-methyl-1,4-dioxonaphthalen-2-yl)methyl]acetamide;hydrochloride
2-amino-N-[(3-methyl-1,4-dioxonaphthalen-2-yl)methyl]acetamide;hydrochloride (PubChem CID 68913429) has the molecular formula C14H15ClN2O3
and a molecular weight of 294.74 g/mol. Its IUPAC name is 2-amino-N-[(3-methyl-1,4-dioxonaphthalen-2-yl)methyl]acetamide;hydrochloride.
Molecular Properties
| Compound Name | 2-amino-N-[(3-methyl-1,4-dioxonaphthalen-2-yl)methyl]acetamide;hydrochloride |
| PubChem CID | 68913429 |
| Molecular Formula | C14H15ClN2O3 |
| Molecular Weight | 294.74 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 2-amino-N-[(3-methyl-1,4-dioxonaphthalen-2-yl)methyl]acetamide;hydrochloride |
| SMILES | CC1=C(CNC(=O)CN)C(=O)c2ccccc2C1=O.Cl |
| InChI | InChI=1S/C14H14N2O3.ClH/c1-8-11(7-16-12(17)6-15)14(19)10-5-3-2-4-9(10)13(8)18;/h2-5H,6-7,15H2,1H3,(H,16,17);1H |
| InChIKey | PZCJPDDPKPFGJN-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.74 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-N-[(3-methyl-1,4-dioxonaphthalen-2-yl)methyl]acetamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-[(3-methyl-1,4-dioxonaphthalen-2-yl)methyl]acetamide;hydrochloride?
The IUPAC name of 2-amino-N-[(3-methyl-1,4-dioxonaphthalen-2-yl)methyl]acetamide;hydrochloride (CID 68913429) is 2-amino-N-[(3-methyl-1,4-dioxonaphthalen-2-yl)methyl]acetamide;hydrochloride.
What is the SMILES notation for 2-amino-N-[(3-methyl-1,4-dioxonaphthalen-2-yl)methyl]acetamide;hydrochloride?
The canonical SMILES for 2-amino-N-[(3-methyl-1,4-dioxonaphthalen-2-yl)methyl]acetamide;hydrochloride is CC1=C(CNC(=O)CN)C(=O)c2ccccc2C1=O.Cl.
What is the InChIKey of 2-amino-N-[(3-methyl-1,4-dioxonaphthalen-2-yl)methyl]acetamide;hydrochloride?
The InChIKey is PZCJPDDPKPFGJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2O3.ClH/c1-8-11(7-16-12(17)6-15)14(19)10-5-3-2-4-9(10)13(8)18;/h2-5H,6-7,15H2,1H3,(H,16,17);1H.
What are the key properties of 2-amino-N-[(3-methyl-1,4-dioxonaphthalen-2-yl)methyl]acetamide;hydrochloride?
2-amino-N-[(3-methyl-1,4-dioxonaphthalen-2-yl)methyl]acetamide;hydrochloride has a molecular weight of 294.74 g/mol, XLogP of 0.88, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-[(3-methyl-1,4-dioxonaphthalen-2-yl)methyl]acetamide;hydrochloride is sourced from PubChem (CID 68913429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).