C14H15ClN2O3 — CID 68913429
2-amino-N-[(3-methyl-1,4-dioxonaphthalen-2-yl)methyl]acetamide;hydrochloride (PubChem CID 68913429) has the molecular formula C14H15ClN2O3 and a molecular weight of 294.74 g/mol. Its IUPAC name is 2-amino-N-[(3-methyl-1,4-dioxonaphthalen-2-yl)methyl]acetamide;hydrochloride.
| Compound Name | 2-amino-N-[(3-methyl-1,4-dioxonaphthalen-2-yl)methyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 68913429 |
| Molecular Formula | C14H15ClN2O3 |
| Molecular Weight | 294.74 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 2-amino-N-[(3-methyl-1,4-dioxonaphthalen-2-yl)methyl]acetamide;hydrochloride |
| SMILES | CC1=C(CNC(=O)CN)C(=O)c2ccccc2C1=O.Cl |
| InChI | InChI=1S/C14H14N2O3.ClH/c1-8-11(7-16-12(17)6-15)14(19)10-5-3-2-4-9(10)13(8)18;/h2-5H,6-7,15H2,1H3,(H,16,17);1H |
| InChIKey | PZCJPDDPKPFGJN-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.74 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|