C18H22N2O3 — CID 57429025
2-[(4R)-2,4-diamino-5-methyl-3-oxohexyl]-3-methylnaphthalene-1,4-dione (PubChem CID 57429025) has the molecular formula C18H22N2O3 and a molecular weight of 314.38 g/mol. Its IUPAC name is 2-[(4R)-2,4-diamino-5-methyl-3-oxohexyl]-3-methylnaphthalene-1,4-dione.
| Compound Name | 2-[(4R)-2,4-diamino-5-methyl-3-oxohexyl]-3-methylnaphthalene-1,4-dione |
|---|---|
| PubChem CID | 57429025 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 2-[(4R)-2,4-diamino-5-methyl-3-oxohexyl]-3-methylnaphthalene-1,4-dione |
| SMILES | CC1=C(CC(N)C(=O)[C@H](N)C(C)C)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H22N2O3/c1-9(2)15(20)18(23)14(19)8-13-10(3)16(21)11-6-4-5-7-12(11)17(13)22/h4-7,9,14-15H,8,19-20H2,1-3H3/t14?,15-/m1/s1 |
| InChIKey | DPJOSMPBCYMLIE-YSSOQSIOSA-N |
| XLogP | 1.65 |
| TPSA | 103.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|