C8H12N2O10 — CID 91548180
2-hydroxy-7,8-dinitrooxy-3-oxooctanoic acid (PubChem CID 91548180) has the molecular formula C8H12N2O10 and a molecular weight of 296.19 g/mol. Its IUPAC name is 2-hydroxy-7,8-dinitrooxy-3-oxooctanoic acid.
| Compound Name | 2-hydroxy-7,8-dinitrooxy-3-oxooctanoic acid |
|---|---|
| PubChem CID | 91548180 |
| Molecular Formula | C8H12N2O10 |
| Molecular Weight | 296.19 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | 2-hydroxy-7,8-dinitrooxy-3-oxooctanoic acid |
| SMILES | O=C(O)C(O)C(=O)CCCC(CO[N+](=O)[O-])O[N+](=O)[O-] |
| InChI | InChI=1S/C8H12N2O10/c11-6(7(12)8(13)14)3-1-2-5(20-10(17)18)4-19-9(15)16/h5,7,12H,1-4H2,(H,13,14) |
| InChIKey | OONYFDKTHVJHQE-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 179.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.19 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|