C18H29N3O12 — CID 53373324
2-[1-[[1-[(5R)-5,6-dinitrooxyhexanoyl]oxyethoxycarbonylamino]methyl]cyclohexyl]acetic acid (PubChem CID 53373324) has the molecular formula C18H29N3O12 and a molecular weight of 479.44 g/mol. Its IUPAC name is 2-[1-[[1-[(5R)-5,6-dinitrooxyhexanoyl]oxyethoxycarbonylamino]methyl]cyclohexyl]acetic acid.
| Compound Name | 2-[1-[[1-[(5R)-5,6-dinitrooxyhexanoyl]oxyethoxycarbonylamino]methyl]cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 53373324 |
| Molecular Formula | C18H29N3O12 |
| Molecular Weight | 479.44 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | 2-[1-[[1-[(5R)-5,6-dinitrooxyhexanoyl]oxyethoxycarbonylamino]methyl]cyclohexyl]acetic acid |
| SMILES | CC(OC(=O)CCC[C@H](CO[N+](=O)[O-])O[N+](=O)[O-])OC(=O)NCC1(CC(=O)O)CCCCC1 |
| InChI | InChI=1S/C18H29N3O12/c1-13(31-16(24)7-5-6-14(33-21(28)29)11-30-20(26)27)32-17(25)19-12-18(10-15(22)23)8-3-2-4-9-18/h13-14H,2-12H2,1H3,(H,19,25)(H,22,23)/t13?,14-/m1/s1 |
| InChIKey | OVOSGERFAYOBLZ-ARLHGKGLSA-N |
| XLogP | 1.98 |
| TPSA | 206.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.44 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|