C18H30N2O11 — CID 53371621
2-[1-[[1-[2-[(2S)-3-methoxy-2-nitrooxypropoxy]acetyl]oxyethoxycarbonylamino]methyl]cyclohexyl]acetic acid (PubChem CID 53371621) has the molecular formula C18H30N2O11 and a molecular weight of 450.44 g/mol. Its IUPAC name is 2-[1-[[1-[2-[(2S)-3-methoxy-2-nitrooxypropoxy]acetyl]oxyethoxycarbonylamino]methyl]cyclohexyl]acetic acid.
| Compound Name | 2-[1-[[1-[2-[(2S)-3-methoxy-2-nitrooxypropoxy]acetyl]oxyethoxycarbonylamino]methyl]cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 53371621 |
| Molecular Formula | C18H30N2O11 |
| Molecular Weight | 450.44 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | 2-[1-[[1-[2-[(2S)-3-methoxy-2-nitrooxypropoxy]acetyl]oxyethoxycarbonylamino]methyl]cyclohexyl]acetic acid |
| SMILES | COC[C@@H](COCC(=O)OC(C)OC(=O)NCC1(CC(=O)O)CCCCC1)O[N+](=O)[O-] |
| InChI | InChI=1S/C18H30N2O11/c1-13(29-16(23)11-28-10-14(9-27-2)31-20(25)26)30-17(24)19-12-18(8-15(21)22)6-4-3-5-7-18/h13-14H,3-12H2,1-2H3,(H,19,24)(H,21,22)/t13?,14-/m0/s1 |
| InChIKey | MERYPRUVXHHVIL-KZUDCZAMSA-N |
| XLogP | 1.27 |
| TPSA | 172.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.44 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|