C16H27NO6 — CID 91438858
2-[1-[(4-acetyloxybutoxycarbonylamino)methyl]cyclohexyl]acetic acid (PubChem CID 91438858) has the molecular formula C16H27NO6 and a molecular weight of 329.39 g/mol. Its IUPAC name is 2-[1-[(4-acetyloxybutoxycarbonylamino)methyl]cyclohexyl]acetic acid.
| Compound Name | 2-[1-[(4-acetyloxybutoxycarbonylamino)methyl]cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 91438858 |
| Molecular Formula | C16H27NO6 |
| Molecular Weight | 329.39 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | 2-[1-[(4-acetyloxybutoxycarbonylamino)methyl]cyclohexyl]acetic acid |
| SMILES | CC(=O)OCCCCOC(=O)NCC1(CC(=O)O)CCCCC1 |
| InChI | InChI=1S/C16H27NO6/c1-13(18)22-9-5-6-10-23-15(21)17-12-16(11-14(19)20)7-3-2-4-8-16/h2-12H2,1H3,(H,17,21)(H,19,20) |
| InChIKey | OSFIAIRDXXEIFH-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.39 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|