C25H43NO7S2 — CID 58607975
2-[1-[[2-[2-(4-oxo-5-propyloctanoyl)oxyethyldisulfanyl]ethoxycarbonylamino]methyl]cyclohexyl]acetic acid (PubChem CID 58607975) has the molecular formula C25H43NO7S2 and a molecular weight of 533.75 g/mol. Its IUPAC name is 2-[1-[[2-[2-(4-oxo-5-propyloctanoyl)oxyethyldisulfanyl]ethoxycarbonylamino]methyl]cyclohexyl]acetic acid.
| Compound Name | 2-[1-[[2-[2-(4-oxo-5-propyloctanoyl)oxyethyldisulfanyl]ethoxycarbonylamino]methyl]cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 58607975 |
| Molecular Formula | C25H43NO7S2 |
| Molecular Weight | 533.75 g/mol |
| Exact Mass | 533.25 |
| IUPAC Name | 2-[1-[[2-[2-(4-oxo-5-propyloctanoyl)oxyethyldisulfanyl]ethoxycarbonylamino]methyl]cyclohexyl]acetic acid |
| SMILES | CCCC(CCC)C(=O)CCC(=O)OCCSSCCOC(=O)NCC1(CC(=O)O)CCCCC1 |
| InChI | InChI=1S/C25H43NO7S2/c1-3-8-20(9-4-2)21(27)10-11-23(30)32-14-16-34-35-17-15-33-24(31)26-19-25(18-22(28)29)12-6-5-7-13-25/h20H,3-19H2,1-2H3,(H,26,31)(H,28,29) |
| InChIKey | AYTKVEZAXNKFGI-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.75 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|