C16H27NO6S2 — CID 89001347
2-[2-[[1-[(4-methyl-1,3-dioxetan-2-yl)methyl]cyclohexyl]methylcarbamoyloxy]ethyldisulfanyl]acetic acid (PubChem CID 89001347) has the molecular formula C16H27NO6S2 and a molecular weight of 393.53 g/mol. Its IUPAC name is 2-[2-[[1-[(4-methyl-1,3-dioxetan-2-yl)methyl]cyclohexyl]methylcarbamoyloxy]ethyldisulfanyl]acetic acid.
| Compound Name | 2-[2-[[1-[(4-methyl-1,3-dioxetan-2-yl)methyl]cyclohexyl]methylcarbamoyloxy]ethyldisulfanyl]acetic acid |
|---|---|
| PubChem CID | 89001347 |
| Molecular Formula | C16H27NO6S2 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | 2-[2-[[1-[(4-methyl-1,3-dioxetan-2-yl)methyl]cyclohexyl]methylcarbamoyloxy]ethyldisulfanyl]acetic acid |
| SMILES | CC1OC(CC2(CNC(=O)OCCSSCC(=O)O)CCCCC2)O1 |
| InChI | InChI=1S/C16H27NO6S2/c1-12-22-14(23-12)9-16(5-3-2-4-6-16)11-17-15(20)21-7-8-24-25-10-13(18)19/h12,14H,2-11H2,1H3,(H,17,20)(H,18,19) |
| InChIKey | IMALHNUUYRDNIU-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|