C16H28N2O5S2 — CID 11689715
2-[2-[[1-(2-amino-2-oxoethyl)cyclohexyl]methylcarbamoyloxy]ethyldisulfanyl]ethyl acetate (PubChem CID 11689715) has the molecular formula C16H28N2O5S2 and a molecular weight of 392.54 g/mol. Its IUPAC name is 2-[2-[[1-(2-amino-2-oxoethyl)cyclohexyl]methylcarbamoyloxy]ethyldisulfanyl]ethyl acetate.
| Compound Name | 2-[2-[[1-(2-amino-2-oxoethyl)cyclohexyl]methylcarbamoyloxy]ethyldisulfanyl]ethyl acetate |
|---|---|
| PubChem CID | 11689715 |
| Molecular Formula | C16H28N2O5S2 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | 2-[2-[[1-(2-amino-2-oxoethyl)cyclohexyl]methylcarbamoyloxy]ethyldisulfanyl]ethyl acetate |
| SMILES | CC(=O)OCCSSCCOC(=O)NCC1(CC(N)=O)CCCCC1 |
| InChI | InChI=1S/C16H28N2O5S2/c1-13(19)22-7-9-24-25-10-8-23-15(21)18-12-16(11-14(17)20)5-3-2-4-6-16/h2-12H2,1H3,(H2,17,20)(H,18,21) |
| InChIKey | UPKOCQKLXMYUSX-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|