C27H50N2O5S2 — CID 58493110
2-[2-[(1-propylcyclohexyl)methylcarbamoyloxy]ethyldisulfanyl]ethyl 4-(2-propylpentanoylamino)butanoate (PubChem CID 58493110) has the molecular formula C27H50N2O5S2 and a molecular weight of 546.84 g/mol. Its IUPAC name is 2-[2-[(1-propylcyclohexyl)methylcarbamoyloxy]ethyldisulfanyl]ethyl 4-(2-propylpentanoylamino)butanoate.
| Compound Name | 2-[2-[(1-propylcyclohexyl)methylcarbamoyloxy]ethyldisulfanyl]ethyl 4-(2-propylpentanoylamino)butanoate |
|---|---|
| PubChem CID | 58493110 |
| Molecular Formula | C27H50N2O5S2 |
| Molecular Weight | 546.84 g/mol |
| Exact Mass | 546.32 |
| IUPAC Name | 2-[2-[(1-propylcyclohexyl)methylcarbamoyloxy]ethyldisulfanyl]ethyl 4-(2-propylpentanoylamino)butanoate |
| SMILES | CCCC(CCC)C(=O)NCCCC(=O)OCCSSCCOC(=O)NCC1(CCC)CCCCC1 |
| InChI | InChI=1S/C27H50N2O5S2/c1-4-11-23(12-5-2)25(31)28-17-10-13-24(30)33-18-20-35-36-21-19-34-26(32)29-22-27(14-6-3)15-8-7-9-16-27/h23H,4-22H2,1-3H3,(H,28,31)(H,29,32) |
| InChIKey | DZCSDKTWKPOMPG-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.84 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|